C16H21NO5 — CID 172670646
4-[[(3aS,5R,6R,7aR)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]oxy]-3-methoxybenzoic acid (PubChem CID 172670646) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-[[(3aS,5R,6R,7aR)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]oxy]-3-methoxybenzoic acid.
| Compound Name | 4-[[(3aS,5R,6R,7aR)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]oxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 172670646 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 4-[[(3aS,5R,6R,7aR)-6-hydroxy-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]oxy]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1O[C@@H]1C[C@@H]2CNC[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C16H21NO5/c1-21-15-5-9(16(19)20)2-3-13(15)22-14-6-11-8-17-7-10(11)4-12(14)18/h2-3,5,10-12,14,17-18H,4,6-8H2,1H3,(H,19,20)/t10-,11+,12+,14+/m0/s1 |
| InChIKey | XETUTNOLCLEFLL-FMCLSXCISA-N |
| XLogP | 1.13 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |