C14H17ClO4S2 — CID 54543062
methyl 4-(4-chlorophenyl)sulfonylsulfanylcyclohexane-1-carboxylate (PubChem CID 54543062) has the molecular formula C14H17ClO4S2 and a molecular weight of 348.87 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)sulfonylsulfanylcyclohexane-1-carboxylate.
| Compound Name | methyl 4-(4-chlorophenyl)sulfonylsulfanylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 54543062 |
| Molecular Formula | C14H17ClO4S2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | methyl 4-(4-chlorophenyl)sulfonylsulfanylcyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(SS(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C14H17ClO4S2/c1-19-14(16)10-2-6-12(7-3-10)20-21(17,18)13-8-4-11(15)5-9-13/h4-5,8-10,12H,2-3,6-7H2,1H3 |
| InChIKey | ZEPJVBZCTPCNLC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|