C12H15NO3 — CID 54543930
3,3-dimethoxy-1,6-dimethylindol-2-one (PubChem CID 54543930) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3,3-dimethoxy-1,6-dimethylindol-2-one.
| Compound Name | 3,3-dimethoxy-1,6-dimethylindol-2-one |
|---|---|
| PubChem CID | 54543930 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 3,3-dimethoxy-1,6-dimethylindol-2-one |
| SMILES | COC1(OC)C(=O)N(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C12H15NO3/c1-8-5-6-9-10(7-8)13(2)11(14)12(9,15-3)16-4/h5-7H,1-4H3 |
| InChIKey | ZFFJUSFSRXNCBJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|