C12H7Cl3N2O4 — CID 54546740
4,4-dichloro-2-(4-chloro-2-nitrobenzoyl)-3-oxopentanenitrile (PubChem CID 54546740) has the molecular formula C12H7Cl3N2O4 and a molecular weight of 349.56 g/mol. Its IUPAC name is 4,4-dichloro-2-(4-chloro-2-nitrobenzoyl)-3-oxopentanenitrile.
| Compound Name | 4,4-dichloro-2-(4-chloro-2-nitrobenzoyl)-3-oxopentanenitrile |
|---|---|
| PubChem CID | 54546740 |
| Molecular Formula | C12H7Cl3N2O4 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 4,4-dichloro-2-(4-chloro-2-nitrobenzoyl)-3-oxopentanenitrile |
| SMILES | CC(Cl)(Cl)C(=O)C(C#N)C(=O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7Cl3N2O4/c1-12(14,15)11(19)8(5-16)10(18)7-3-2-6(13)4-9(7)17(20)21/h2-4,8H,1H3 |
| InChIKey | ZHAUCAMEXPFZIL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 101.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|