C12H7ClF2N2O4 — CID 67899758
2-[(4-chloro-2-nitrophenyl)-hydroxymethylidene]-4,4-difluoro-3-oxopentanenitrile (PubChem CID 67899758) has the molecular formula C12H7ClF2N2O4 and a molecular weight of 316.65 g/mol. Its IUPAC name is 2-[(4-chloro-2-nitrophenyl)-hydroxymethylidene]-4,4-difluoro-3-oxopentanenitrile.
| Compound Name | 2-[(4-chloro-2-nitrophenyl)-hydroxymethylidene]-4,4-difluoro-3-oxopentanenitrile |
|---|---|
| PubChem CID | 67899758 |
| Molecular Formula | C12H7ClF2N2O4 |
| Molecular Weight | 316.65 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-[(4-chloro-2-nitrophenyl)-hydroxymethylidene]-4,4-difluoro-3-oxopentanenitrile |
| SMILES | CC(F)(F)C(=O)C(C#N)=C(O)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H7ClF2N2O4/c1-12(14,15)11(19)8(5-16)10(18)7-3-2-6(13)4-9(7)17(20)21/h2-4,18H,1H3 |
| InChIKey | QRLQLSWTDSXMQH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|