C9H10BrNO2 — CID 54551428
2-(5-bromofuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 54551428) has the molecular formula C9H10BrNO2 and a molecular weight of 244.09 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(5-bromofuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 54551428 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccc(Br)o2)=N1 |
| InChI | InChI=1S/C9H10BrNO2/c1-9(2)5-12-8(11-9)6-3-4-7(10)13-6/h3-4H,5H2,1-2H3 |
| InChIKey | ZKEASIZDEJXFMR-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 34.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |