C26H30N4O9 — CID 54551750
[(3S)-3-amino-4-[2-[(2S)-2-aminopropanoyl]oxyphenyl]-4-oxobutanoyl] (3S)-3-amino-4-[2-[(2S)-2-aminopropanoyl]oxyphenyl]-4-oxobutanoate (PubChem CID 54551750) has the molecular formula C26H30N4O9 and a molecular weight of 542.55 g/mol. Its IUPAC name is [(3S)-3-amino-4-[2-[(2S)-2-aminopropanoyl]oxyphenyl]-4-oxobutanoyl] (3S)-3-amino-4-[2-[(2S)-2-aminopropanoyl]oxyphenyl]-4-oxobutanoate.
| Compound Name | [(3S)-3-amino-4-[2-[(2S)-2-aminopropanoyl]oxyphenyl]-4-oxobutanoyl] (3S)-3-amino-4-[2-[(2S)-2-aminopropanoyl]oxyphenyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 54551750 |
| Molecular Formula | C26H30N4O9 |
| Molecular Weight | 542.55 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | [(3S)-3-amino-4-[2-[(2S)-2-aminopropanoyl]oxyphenyl]-4-oxobutanoyl] (3S)-3-amino-4-[2-[(2S)-2-aminopropanoyl]oxyphenyl]-4-oxobutanoate |
| SMILES | C[C@H](N)C(=O)Oc1ccccc1C(=O)[C@@H](N)CC(=O)OC(=O)C[C@H](N)C(=O)c1ccccc1OC(=O)[C@H](C)N |
| InChI | InChI=1S/C26H30N4O9/c1-13(27)25(35)37-19-9-5-3-7-15(19)23(33)17(29)11-21(31)39-22(32)12-18(30)24(34)16-8-4-6-10-20(16)38-26(36)14(2)28/h3-10,13-14,17-18H,11-12,27-30H2,1-2H3/t13-,14-,17-,18-/m0/s1 |
| InChIKey | ZKJQNYFJYKXAKW-USJZOSNVSA-N |
| XLogP | -0.24 |
| TPSA | 234.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.55 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|