C11H14F3N4O+ — CID 54553250
carbamimidoyl-carbamoyl-methyl-[2-methyl-6-(trifluoromethyl)phenyl]azanium (PubChem CID 54553250) has the molecular formula C11H14F3N4O+ and a molecular weight of 275.25 g/mol. Its IUPAC name is carbamimidoyl-carbamoyl-methyl-[2-methyl-6-(trifluoromethyl)phenyl]azanium.
| Compound Name | carbamimidoyl-carbamoyl-methyl-[2-methyl-6-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 54553250 |
| Molecular Formula | C11H14F3N4O+ |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | carbamimidoyl-carbamoyl-methyl-[2-methyl-6-(trifluoromethyl)phenyl]azanium |
| SMILES | [H]/N=C(\N)[N+](C)(C(N)=O)c1c(C)cccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3N4O/c1-6-4-3-5-7(11(12,13)14)8(6)18(2,9(15)16)10(17)19/h3-5H,1-2H3,(H4-,15,16,17,19)/p+1 |
| InChIKey | NRDRWCUMQXZWOE-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 92.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|