C15H19NO4 — CID 54554838
[(4S)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-benzyl-N-methylcarbamate (PubChem CID 54554838) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is [(4S)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-benzyl-N-methylcarbamate.
| Compound Name | [(4S)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-benzyl-N-methylcarbamate |
|---|---|
| PubChem CID | 54554838 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [(4S)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] N-benzyl-N-methylcarbamate |
| SMILES | CN(Cc1ccccc1)C(=O)O[C@@H]1COC2OCCC21 |
| InChI | InChI=1S/C15H19NO4/c1-16(9-11-5-3-2-4-6-11)15(17)20-13-10-19-14-12(13)7-8-18-14/h2-6,12-14H,7-10H2,1H3/t12?,13-,14?/m1/s1 |
| InChIKey | ZMLGKEOTGYLZJB-ROKHWSDSSA-N |
| XLogP | 2.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |