C22H19NO4 — CID 54555234
benzyl N-(4-naphthalen-2-yl-1,4-dioxobutan-2-yl)carbamate (PubChem CID 54555234) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is benzyl N-(4-naphthalen-2-yl-1,4-dioxobutan-2-yl)carbamate.
| Compound Name | benzyl N-(4-naphthalen-2-yl-1,4-dioxobutan-2-yl)carbamate |
|---|---|
| PubChem CID | 54555234 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | benzyl N-(4-naphthalen-2-yl-1,4-dioxobutan-2-yl)carbamate |
| SMILES | O=CC(CC(=O)c1ccc2ccccc2c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H19NO4/c24-14-20(23-22(26)27-15-16-6-2-1-3-7-16)13-21(25)19-11-10-17-8-4-5-9-18(17)12-19/h1-12,14,20H,13,15H2,(H,23,26) |
| InChIKey | KPYWMWRUYJWXRM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|