C23H22N2O6 — CID 54555867
(2,5-dihydroxypyrrol-1-yl) 4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate (PubChem CID 54555867) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 54555867 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-(9H-fluoren-9-ylmethoxycarbonylamino)butanoate |
| SMILES | O=C(CCCNC(=O)OCC1c2ccccc2-c2ccccc21)On1c(O)ccc1O |
| InChI | InChI=1S/C23H22N2O6/c26-20-11-12-21(27)25(20)31-22(28)10-5-13-24-23(29)30-14-19-17-8-3-1-6-15(17)16-7-2-4-9-18(16)19/h1-4,6-9,11-12,19,26-27H,5,10,13-14H2,(H,24,29) |
| InChIKey | ZNDBQFSSUXFLDN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|