C20H19NO5S2 — CID 54557419
(4R)-3-(3-acetylsulfanyl-4-naphthalen-2-yl-4-oxobutanoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 54557419) has the molecular formula C20H19NO5S2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (4R)-3-(3-acetylsulfanyl-4-naphthalen-2-yl-4-oxobutanoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(3-acetylsulfanyl-4-naphthalen-2-yl-4-oxobutanoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 54557419 |
| Molecular Formula | C20H19NO5S2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | (4R)-3-(3-acetylsulfanyl-4-naphthalen-2-yl-4-oxobutanoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)SC(CC(=O)N1CSC[C@H]1C(=O)O)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H19NO5S2/c1-12(22)28-17(9-18(23)21-11-27-10-16(21)20(25)26)19(24)15-7-6-13-4-2-3-5-14(13)8-15/h2-8,16-17H,9-11H2,1H3,(H,25,26)/t16-,17?/m0/s1 |
| InChIKey | ZODIJSWEQAQBOZ-BHWOMJMDSA-N |
| XLogP | 3.05 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|