C28H28Cl3FN2O4 — CID 54557694
2-chloro-N-[3-chloro-4-[2-(2-chloro-4-methylphenoxy)octanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide (PubChem CID 54557694) has the molecular formula C28H28Cl3FN2O4 and a molecular weight of 581.90 g/mol. Its IUPAC name is 2-chloro-N-[3-chloro-4-[2-(2-chloro-4-methylphenoxy)octanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide.
| Compound Name | 2-chloro-N-[3-chloro-4-[2-(2-chloro-4-methylphenoxy)octanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 54557694 |
| Molecular Formula | C28H28Cl3FN2O4 |
| Molecular Weight | 581.90 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | 2-chloro-N-[3-chloro-4-[2-(2-chloro-4-methylphenoxy)octanoylamino]-5-fluoro-2-hydroxyphenyl]benzamide |
| SMILES | CCCCCCC(Oc1ccc(C)cc1Cl)C(=O)Nc1c(F)cc(NC(=O)c2ccccc2Cl)c(O)c1Cl |
| InChI | InChI=1S/C28H28Cl3FN2O4/c1-3-4-5-6-11-23(38-22-13-12-16(2)14-19(22)30)28(37)34-25-20(32)15-21(26(35)24(25)31)33-27(36)17-9-7-8-10-18(17)29/h7-10,12-15,23,35H,3-6,11H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | ZOHVXHRHXPTLHZ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.90 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|