C14H20O3 — CID 54560266
1,2-bis(7-oxabicyclo[4.1.0]heptan-3-yl)ethanone (PubChem CID 54560266) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1,2-bis(7-oxabicyclo[4.1.0]heptan-3-yl)ethanone.
| Compound Name | 1,2-bis(7-oxabicyclo[4.1.0]heptan-3-yl)ethanone |
|---|---|
| PubChem CID | 54560266 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 1,2-bis(7-oxabicyclo[4.1.0]heptan-3-yl)ethanone |
| SMILES | O=C(CC1CCC2OC2C1)C1CCC2OC2C1 |
| InChI | InChI=1S/C14H20O3/c15-10(9-2-4-12-14(7-9)17-12)5-8-1-3-11-13(6-8)16-11/h8-9,11-14H,1-7H2 |
| InChIKey | ZQAXDHSHDQOFHU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|