C24H30O7 — CID 20707299
3-(7-oxabicyclo[4.1.0]heptan-3-yl)-1-[4-[3-(7-oxabicyclo[4.1.0]heptan-3-yl)-2-oxopropanoyl]-7-oxabicyclo[4.1.0]heptan-3-yl]propane-1,2-dione (PubChem CID 20707299) has the molecular formula C24H30O7 and a molecular weight of 430.50 g/mol. Its IUPAC name is 3-(7-oxabicyclo[4.1.0]heptan-3-yl)-1-[4-[3-(7-oxabicyclo[4.1.0]heptan-3-yl)-2-oxopropanoyl]-7-oxabicyclo[4.1.0]heptan-3-yl]propane-1,2-dione.
| Compound Name | 3-(7-oxabicyclo[4.1.0]heptan-3-yl)-1-[4-[3-(7-oxabicyclo[4.1.0]heptan-3-yl)-2-oxopropanoyl]-7-oxabicyclo[4.1.0]heptan-3-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 20707299 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-(7-oxabicyclo[4.1.0]heptan-3-yl)-1-[4-[3-(7-oxabicyclo[4.1.0]heptan-3-yl)-2-oxopropanoyl]-7-oxabicyclo[4.1.0]heptan-3-yl]propane-1,2-dione |
| SMILES | O=C(CC1CCC2OC2C1)C(=O)C1CC2OC2CC1C(=O)C(=O)CC1CCC2OC2C1 |
| InChI | InChI=1S/C24H30O7/c25-15(5-11-1-3-17-19(7-11)29-17)23(27)13-9-21-22(31-21)10-14(13)24(28)16(26)6-12-2-4-18-20(8-12)30-18/h11-14,17-22H,1-10H2 |
| InChIKey | NGPOKUCROZWKEY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 105.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|