C10H15NO3 — CID 87626588
2-(7-oxabicyclo[4.1.0]heptan-3-ylmethylamino)prop-2-enoic acid (PubChem CID 87626588) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(7-oxabicyclo[4.1.0]heptan-3-ylmethylamino)prop-2-enoic acid.
| Compound Name | 2-(7-oxabicyclo[4.1.0]heptan-3-ylmethylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 87626588 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-(7-oxabicyclo[4.1.0]heptan-3-ylmethylamino)prop-2-enoic acid |
| SMILES | C=C(NCC1CCC2OC2C1)C(=O)O |
| InChI | InChI=1S/C10H15NO3/c1-6(10(12)13)11-5-7-2-3-8-9(4-7)14-8/h7-9,11H,1-5H2,(H,12,13) |
| InChIKey | JQDTWJSDDIGBTI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 61.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|