C16H25NO4 — CID 18522643
2-(7-oxabicyclo[4.1.0]heptan-1-yl)ethyl N-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)carbamate (PubChem CID 18522643) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-(7-oxabicyclo[4.1.0]heptan-1-yl)ethyl N-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)carbamate.
| Compound Name | 2-(7-oxabicyclo[4.1.0]heptan-1-yl)ethyl N-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 18522643 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-(7-oxabicyclo[4.1.0]heptan-1-yl)ethyl N-(7-oxabicyclo[4.1.0]heptan-3-ylmethyl)carbamate |
| SMILES | O=C(NCC1CCC2OC2C1)OCCC12CCCCC1O2 |
| InChI | InChI=1S/C16H25NO4/c18-15(17-10-11-4-5-12-13(9-11)20-12)19-8-7-16-6-2-1-3-14(16)21-16/h11-14H,1-10H2,(H,17,18) |
| InChIKey | NOKWUBYHQFXGJC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|