C34H50O10 — CID 175750856
bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) hexanedioate;6-(7-oxabicyclo[4.1.0]heptan-1-ylmethyl)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid (PubChem CID 175750856) has the molecular formula C34H50O10 and a molecular weight of 618.76 g/mol. Its IUPAC name is bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) hexanedioate;6-(7-oxabicyclo[4.1.0]heptan-1-ylmethyl)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid.
| Compound Name | bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) hexanedioate;6-(7-oxabicyclo[4.1.0]heptan-1-ylmethyl)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 175750856 |
| Molecular Formula | C34H50O10 |
| Molecular Weight | 618.76 g/mol |
| Exact Mass | 618.34 |
| IUPAC Name | bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) hexanedioate;6-(7-oxabicyclo[4.1.0]heptan-1-ylmethyl)-7-oxabicyclo[4.1.0]heptane-3-carboxylic acid |
| SMILES | O=C(CCCCC(=O)OCC1CCC2OC2C1)OCC1CCC2OC2C1.O=C(O)C1CCC2(CC34CCCCC3O4)OC2C1 |
| InChI | InChI=1S/C20H30O6.C14H20O4/c21-19(23-11-13-5-7-15-17(9-13)25-15)3-1-2-4-20(22)24-12-14-6-8-16-18(10-14)26-16;15-12(16)9-4-6-14(11(7-9)18-14)8-13-5-2-1-3-10(13)17-13/h13-18H,1-12H2;9-11H,1-8H2,(H,15,16) |
| InChIKey | IJDCZWGWLIGLBG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 140.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|