C18H31NO7S — CID 54562906
(2S)-2-[[1-[2-carboxy-3-(2-methoxyethoxy)propyl]cyclopentanecarbonyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 54562906) has the molecular formula C18H31NO7S and a molecular weight of 405.51 g/mol. Its IUPAC name is (2S)-2-[[1-[2-carboxy-3-(2-methoxyethoxy)propyl]cyclopentanecarbonyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[1-[2-carboxy-3-(2-methoxyethoxy)propyl]cyclopentanecarbonyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 54562906 |
| Molecular Formula | C18H31NO7S |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | (2S)-2-[[1-[2-carboxy-3-(2-methoxyethoxy)propyl]cyclopentanecarbonyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | COCCOCC(CC1(C(=O)N[C@@H](CCSC)C(=O)O)CCCC1)C(=O)O |
| InChI | InChI=1S/C18H31NO7S/c1-25-8-9-26-12-13(15(20)21)11-18(6-3-4-7-18)17(24)19-14(16(22)23)5-10-27-2/h13-14H,3-12H2,1-2H3,(H,19,24)(H,20,21)(H,22,23)/t13?,14-/m0/s1 |
| InChIKey | ZRUDPFYYUPPMOW-KZUDCZAMSA-N |
| XLogP | 1.62 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|