C46H42N8O4 — CID 54563582
ethyl 2-[[2-ethoxy-3-[[4-[4-methyl-2-(1-trityltetrazol-5-yl)pyrrol-1-yl]phenyl]methyl]benzimidazole-4-carbonyl]amino]acetate (PubChem CID 54563582) has the molecular formula C46H42N8O4 and a molecular weight of 770.89 g/mol. Its IUPAC name is ethyl 2-[[2-ethoxy-3-[[4-[4-methyl-2-(1-trityltetrazol-5-yl)pyrrol-1-yl]phenyl]methyl]benzimidazole-4-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[2-ethoxy-3-[[4-[4-methyl-2-(1-trityltetrazol-5-yl)pyrrol-1-yl]phenyl]methyl]benzimidazole-4-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 54563582 |
| Molecular Formula | C46H42N8O4 |
| Molecular Weight | 770.89 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | ethyl 2-[[2-ethoxy-3-[[4-[4-methyl-2-(1-trityltetrazol-5-yl)pyrrol-1-yl]phenyl]methyl]benzimidazole-4-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1cccc2nc(OCC)n(Cc3ccc(-n4cc(C)cc4-c4nnnn4C(c4ccccc4)(c4ccccc4)c4ccccc4)cc3)c12 |
| InChI | InChI=1S/C46H42N8O4/c1-4-57-41(55)29-47-44(56)38-22-15-23-39-42(38)53(45(48-39)58-5-2)31-33-24-26-37(27-25-33)52-30-32(3)28-40(52)43-49-50-51-54(43)46(34-16-9-6-10-17-34,35-18-11-7-12-19-35)36-20-13-8-14-21-36/h6-28,30H,4-5,29,31H2,1-3H3,(H,47,56) |
| InChIKey | ZSGVNCOEMBVGRY-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 130.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.89 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|