C46H41N7O5 — CID 67885233
propanoyloxymethyl 2-ethoxy-3-[[4-[4-methyl-2-(1-trityltetrazol-5-yl)pyrrol-1-yl]phenyl]methyl]benzimidazole-4-carboxylate (PubChem CID 67885233) has the molecular formula C46H41N7O5 and a molecular weight of 771.88 g/mol. Its IUPAC name is propanoyloxymethyl 2-ethoxy-3-[[4-[4-methyl-2-(1-trityltetrazol-5-yl)pyrrol-1-yl]phenyl]methyl]benzimidazole-4-carboxylate.
| Compound Name | propanoyloxymethyl 2-ethoxy-3-[[4-[4-methyl-2-(1-trityltetrazol-5-yl)pyrrol-1-yl]phenyl]methyl]benzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 67885233 |
| Molecular Formula | C46H41N7O5 |
| Molecular Weight | 771.88 g/mol |
| Exact Mass | 771.32 |
| IUPAC Name | propanoyloxymethyl 2-ethoxy-3-[[4-[4-methyl-2-(1-trityltetrazol-5-yl)pyrrol-1-yl]phenyl]methyl]benzimidazole-4-carboxylate |
| SMILES | CCOc1nc2cccc(C(=O)OCOC(=O)CC)c2n1Cc1ccc(-n2cc(C)cc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H41N7O5/c1-4-41(54)57-31-58-44(55)38-22-15-23-39-42(38)52(45(47-39)56-5-2)30-33-24-26-37(27-25-33)51-29-32(3)28-40(51)43-48-49-50-53(43)46(34-16-9-6-10-17-34,35-18-11-7-12-19-35)36-20-13-8-14-21-36/h6-29H,4-5,30-31H2,1-3H3 |
| InChIKey | NXJAFBONWODDSL-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 128.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.88 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|