C17H33O4P — CID 54564457
heptadeca-7,9-dien-9-yl dihydrogen phosphate (PubChem CID 54564457) has the molecular formula C17H33O4P and a molecular weight of 332.42 g/mol. Its IUPAC name is heptadeca-7,9-dien-9-yl dihydrogen phosphate.
| Compound Name | heptadeca-7,9-dien-9-yl dihydrogen phosphate |
|---|---|
| PubChem CID | 54564457 |
| Molecular Formula | C17H33O4P |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | heptadeca-7,9-dien-9-yl dihydrogen phosphate |
| SMILES | CCCCCCC=CC(=CCCCCCCC)OP(=O)(O)O |
| InChI | InChI=1S/C17H33O4P/c1-3-5-7-9-11-13-15-17(21-22(18,19)20)16-14-12-10-8-6-4-2/h13,15-16H,3-12,14H2,1-2H3,(H2,18,19,20) |
| InChIKey | ZSVOIQMJMNTDDM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|