C12H15NO5 — CID 54569391
3-(4-ethoxycarbonyl-2-formyl-5-methyl-1H-pyrrol-3-yl)propanoic acid (PubChem CID 54569391) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is 3-(4-ethoxycarbonyl-2-formyl-5-methyl-1H-pyrrol-3-yl)propanoic acid.
| Compound Name | 3-(4-ethoxycarbonyl-2-formyl-5-methyl-1H-pyrrol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 54569391 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 3-(4-ethoxycarbonyl-2-formyl-5-methyl-1H-pyrrol-3-yl)propanoic acid |
| SMILES | CCOC(=O)c1c(C)[nH]c(C=O)c1CCC(=O)O |
| InChI | InChI=1S/C12H15NO5/c1-3-18-12(17)11-7(2)13-9(6-14)8(11)4-5-10(15)16/h6,13H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | ZWDZDEFDQMUNLD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|