C14H19NO5 — CID 91392607
diethyl 5-formyl-3-propan-2-yl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 91392607) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is diethyl 5-formyl-3-propan-2-yl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 5-formyl-3-propan-2-yl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 91392607 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | diethyl 5-formyl-3-propan-2-yl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(C=O)c(C(=O)OCC)c1C(C)C |
| InChI | InChI=1S/C14H19NO5/c1-5-19-13(17)11-9(7-16)15-12(10(11)8(3)4)14(18)20-6-2/h7-8,15H,5-6H2,1-4H3 |
| InChIKey | WDNHHWKEBVHADL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|