C16H20N2O4 — CID 54571439
(5-hydroxy-2-oxo-3-prop-2-ynylimidazol-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate (PubChem CID 54571439) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is (5-hydroxy-2-oxo-3-prop-2-ynylimidazol-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate.
| Compound Name | (5-hydroxy-2-oxo-3-prop-2-ynylimidazol-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54571439 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (5-hydroxy-2-oxo-3-prop-2-ynylimidazol-1-yl) 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | C#CCn1cc(O)n(OC(=O)C2C(C=C(C)C)C2(C)C)c1=O |
| InChI | InChI=1S/C16H20N2O4/c1-6-7-17-9-12(19)18(15(17)21)22-14(20)13-11(8-10(2)3)16(13,4)5/h1,8-9,11,13,19H,7H2,2-5H3 |
| InChIKey | ZXNYWSSCBBBULG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|