C18H17F2NO2 — CID 54575143
(3S,5R)-5-[(2,5-difluorophenyl)methyl]-3-phenyl-1,4-oxazepan-7-one (PubChem CID 54575143) has the molecular formula C18H17F2NO2 and a molecular weight of 317.33 g/mol. Its IUPAC name is (3S,5R)-5-[(2,5-difluorophenyl)methyl]-3-phenyl-1,4-oxazepan-7-one.
| Compound Name | (3S,5R)-5-[(2,5-difluorophenyl)methyl]-3-phenyl-1,4-oxazepan-7-one |
|---|---|
| PubChem CID | 54575143 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (3S,5R)-5-[(2,5-difluorophenyl)methyl]-3-phenyl-1,4-oxazepan-7-one |
| SMILES | O=C1C[C@@H](Cc2cc(F)ccc2F)N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C18H17F2NO2/c19-14-6-7-16(20)13(8-14)9-15-10-18(22)23-11-17(21-15)12-4-2-1-3-5-12/h1-8,15,17,21H,9-11H2/t15-,17-/m1/s1 |
| InChIKey | HAGIQAQCOYVCEQ-NVXWUHKLSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |