C23H19ClF3N3O4S — CID 54577781
1-(4-chloro-1-oxidopyridin-1-ium-2-yl)-1'-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 54577781) has the molecular formula C23H19ClF3N3O4S and a molecular weight of 525.94 g/mol. Its IUPAC name is 1-(4-chloro-1-oxidopyridin-1-ium-2-yl)-1'-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]spiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 1-(4-chloro-1-oxidopyridin-1-ium-2-yl)-1'-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]spiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 54577781 |
| Molecular Formula | C23H19ClF3N3O4S |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 1-(4-chloro-1-oxidopyridin-1-ium-2-yl)-1'-[[5-(trifluoromethyl)-2-pyridinyl]sulfonyl]spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cn1)N1CCC2(CC1)OC(c1cc(Cl)cc[n+]1[O-])c1ccccc12 |
| InChI | InChI=1S/C23H19ClF3N3O4S/c24-16-7-10-30(31)19(13-16)21-17-3-1-2-4-18(17)22(34-21)8-11-29(12-9-22)35(32,33)20-6-5-15(14-28-20)23(25,26)27/h1-7,10,13-14,21H,8-9,11-12H2 |
| InChIKey | VJAJKRJVJUWJBI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|