C23H30F2N2O3 — CID 54579980
(2S)-6-[(4-fluoro-3-methylphenyl)methylamino]-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxyhexanamide (PubChem CID 54579980) has the molecular formula C23H30F2N2O3 and a molecular weight of 420.50 g/mol. Its IUPAC name is (2S)-6-[(4-fluoro-3-methylphenyl)methylamino]-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxyhexanamide.
| Compound Name | (2S)-6-[(4-fluoro-3-methylphenyl)methylamino]-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 54579980 |
| Molecular Formula | C23H30F2N2O3 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (2S)-6-[(4-fluoro-3-methylphenyl)methylamino]-2-[(2R)-2-(4-fluorophenyl)-2-methoxyethyl]-N-hydroxyhexanamide |
| SMILES | CO[C@H](CC(CCCCNCc1ccc(F)c(C)c1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H30F2N2O3/c1-16-13-17(6-11-21(16)25)15-26-12-4-3-5-19(23(28)27-29)14-22(30-2)18-7-9-20(24)10-8-18/h6-11,13,19,22,26,29H,3-5,12,14-15H2,1-2H3,(H,27,28)/t19?,22-/m1/s1 |
| InChIKey | WRWKTNIEVZHRJG-AVKWCDSFSA-N |
| XLogP | 4.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|