C25H34FN3O3 — CID 52945720
(2S,4R)-4-(4-fluorophenyl)-N-hydroxy-4-methoxy-2-[2-[4-(2-phenylethyl)piperazin-1-yl]ethyl]butanamide (PubChem CID 52945720) has the molecular formula C25H34FN3O3 and a molecular weight of 443.56 g/mol. Its IUPAC name is (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-4-methoxy-2-[2-[4-(2-phenylethyl)piperazin-1-yl]ethyl]butanamide.
| Compound Name | (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-4-methoxy-2-[2-[4-(2-phenylethyl)piperazin-1-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 52945720 |
| Molecular Formula | C25H34FN3O3 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-4-methoxy-2-[2-[4-(2-phenylethyl)piperazin-1-yl]ethyl]butanamide |
| SMILES | CO[C@H](C[C@H](CCN1CCN(CCc2ccccc2)CC1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H34FN3O3/c1-32-24(21-7-9-23(26)10-8-21)19-22(25(30)27-31)12-14-29-17-15-28(16-18-29)13-11-20-5-3-2-4-6-20/h2-10,22,24,31H,11-19H2,1H3,(H,27,30)/t22-,24+/m0/s1 |
| InChIKey | JIBIPYGNBCVWPR-LADGPHEKSA-N |
| XLogP | 3.28 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|