C24H32FN3O3 — CID 52946540
(2S,4R)-2-[2-(4-benzylpiperazin-1-yl)ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide (PubChem CID 52946540) has the molecular formula C24H32FN3O3 and a molecular weight of 429.54 g/mol. Its IUPAC name is (2S,4R)-2-[2-(4-benzylpiperazin-1-yl)ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide.
| Compound Name | (2S,4R)-2-[2-(4-benzylpiperazin-1-yl)ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide |
|---|---|
| PubChem CID | 52946540 |
| Molecular Formula | C24H32FN3O3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (2S,4R)-2-[2-(4-benzylpiperazin-1-yl)ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide |
| SMILES | CO[C@H](CC(CCN1CCN(Cc2ccccc2)CC1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32FN3O3/c1-31-23(20-7-9-22(25)10-8-20)17-21(24(29)26-30)11-12-27-13-15-28(16-14-27)18-19-5-3-2-4-6-19/h2-10,21,23,30H,11-18H2,1H3,(H,26,29)/t21?,23-/m1/s1 |
| InChIKey | BUAQHXYXWQNBFC-JFGZAKSSSA-N |
| XLogP | 3.23 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|