C24H32F2N2O3 — CID 25134297
(2S,4R)-2-[2-[3-(4-fluoro-3-methylphenyl)propyl-methylamino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide (PubChem CID 25134297) has the molecular formula C24H32F2N2O3 and a molecular weight of 434.53 g/mol. Its IUPAC name is (2S,4R)-2-[2-[3-(4-fluoro-3-methylphenyl)propyl-methylamino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide.
| Compound Name | (2S,4R)-2-[2-[3-(4-fluoro-3-methylphenyl)propyl-methylamino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide |
|---|---|
| PubChem CID | 25134297 |
| Molecular Formula | C24H32F2N2O3 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | (2S,4R)-2-[2-[3-(4-fluoro-3-methylphenyl)propyl-methylamino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide |
| SMILES | CO[C@H](CC(CCN(C)CCCc1ccc(F)c(C)c1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32F2N2O3/c1-17-15-18(6-11-22(17)26)5-4-13-28(2)14-12-20(24(29)27-30)16-23(31-3)19-7-9-21(25)10-8-19/h6-11,15,20,23,30H,4-5,12-14,16H2,1-3H3,(H,27,29)/t20?,23-/m1/s1 |
| InChIKey | VNXRIINFDPLDNI-GWQXNCQPSA-N |
| XLogP | 4.43 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|