C28H32F2N2O3 — CID 52946940
(2S,4R)-2-[2-[[4-(4-fluoro-3-methylphenyl)phenyl]methyl-methylamino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide (PubChem CID 52946940) has the molecular formula C28H32F2N2O3 and a molecular weight of 482.57 g/mol. Its IUPAC name is (2S,4R)-2-[2-[[4-(4-fluoro-3-methylphenyl)phenyl]methyl-methylamino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide.
| Compound Name | (2S,4R)-2-[2-[[4-(4-fluoro-3-methylphenyl)phenyl]methyl-methylamino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide |
|---|---|
| PubChem CID | 52946940 |
| Molecular Formula | C28H32F2N2O3 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | (2S,4R)-2-[2-[[4-(4-fluoro-3-methylphenyl)phenyl]methyl-methylamino]ethyl]-4-(4-fluorophenyl)-N-hydroxy-4-methoxybutanamide |
| SMILES | CO[C@H](CC(CCN(C)Cc1ccc(-c2ccc(F)c(C)c2)cc1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H32F2N2O3/c1-19-16-23(10-13-26(19)30)21-6-4-20(5-7-21)18-32(2)15-14-24(28(33)31-34)17-27(35-3)22-8-11-25(29)12-9-22/h4-13,16,24,27,34H,14-15,17-18H2,1-3H3,(H,31,33)/t24?,27-/m1/s1 |
| InChIKey | ZHYVUKOWYCPYBC-LFHRXCRSSA-N |
| XLogP | 5.66 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|