C23H31FN2O3 — CID 52948143
(2S,4R)-4-(4-fluorophenyl)-N-hydroxy-4-methoxy-2-[2-[methyl(3-phenylpropyl)amino]ethyl]butanamide (PubChem CID 52948143) has the molecular formula C23H31FN2O3 and a molecular weight of 402.51 g/mol. Its IUPAC name is (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-4-methoxy-2-[2-[methyl(3-phenylpropyl)amino]ethyl]butanamide.
| Compound Name | (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-4-methoxy-2-[2-[methyl(3-phenylpropyl)amino]ethyl]butanamide |
|---|---|
| PubChem CID | 52948143 |
| Molecular Formula | C23H31FN2O3 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (2S,4R)-4-(4-fluorophenyl)-N-hydroxy-4-methoxy-2-[2-[methyl(3-phenylpropyl)amino]ethyl]butanamide |
| SMILES | CO[C@H](C[C@H](CCN(C)CCCc1ccccc1)C(=O)NO)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H31FN2O3/c1-26(15-6-9-18-7-4-3-5-8-18)16-14-20(23(27)25-28)17-22(29-2)19-10-12-21(24)13-11-19/h3-5,7-8,10-13,20,22,28H,6,9,14-17H2,1-2H3,(H,25,27)/t20-,22+/m0/s1 |
| InChIKey | MZVURSTVWFPJEU-RBBKRZOGSA-N |
| XLogP | 3.98 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|