C21H16F3N3O3S — CID 54580421
(5S)-5-methyl-1-(quinolin-4-ylmethyl)-3-[4-(trifluoromethylsulfinyl)phenyl]imidazolidine-2,4-dione (PubChem CID 54580421) has the molecular formula C21H16F3N3O3S and a molecular weight of 447.44 g/mol. Its IUPAC name is (5S)-5-methyl-1-(quinolin-4-ylmethyl)-3-[4-(trifluoromethylsulfinyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-methyl-1-(quinolin-4-ylmethyl)-3-[4-(trifluoromethylsulfinyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 54580421 |
| Molecular Formula | C21H16F3N3O3S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (5S)-5-methyl-1-(quinolin-4-ylmethyl)-3-[4-(trifluoromethylsulfinyl)phenyl]imidazolidine-2,4-dione |
| SMILES | C[C@H]1C(=O)N(c2ccc(S(=O)C(F)(F)F)cc2)C(=O)N1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C21H16F3N3O3S/c1-13-19(28)27(15-6-8-16(9-7-15)31(30)21(22,23)24)20(29)26(13)12-14-10-11-25-18-5-3-2-4-17(14)18/h2-11,13H,12H2,1H3/t13-,31?/m0/s1 |
| InChIKey | FMMBZSGUGDMZPC-ZMGDOUPYSA-N |
| XLogP | 4.22 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|