C22H20ClFN4O — CID 54583006
[4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]piperidin-1-yl]-(3-fluorophenyl)methanone (PubChem CID 54583006) has the molecular formula C22H20ClFN4O and a molecular weight of 410.88 g/mol. Its IUPAC name is [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]piperidin-1-yl]-(3-fluorophenyl)methanone.
| Compound Name | [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]piperidin-1-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 54583006 |
| Molecular Formula | C22H20ClFN4O |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [4-[[4-(4-chlorophenyl)pyrimidin-2-yl]amino]piperidin-1-yl]-(3-fluorophenyl)methanone |
| SMILES | O=C(c1cccc(F)c1)N1CCC(Nc2nccc(-c3ccc(Cl)cc3)n2)CC1 |
| InChI | InChI=1S/C22H20ClFN4O/c23-17-6-4-15(5-7-17)20-8-11-25-22(27-20)26-19-9-12-28(13-10-19)21(29)16-2-1-3-18(24)14-16/h1-8,11,14,19H,9-10,12-13H2,(H,25,26,27) |
| InChIKey | FKHKUSXQZQNMPM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |