C13H7N3O2S — CID 54584297
3-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-5-nitrobenzonitrile (PubChem CID 54584297) has the molecular formula C13H7N3O2S and a molecular weight of 269.29 g/mol. Its IUPAC name is 3-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-5-nitrobenzonitrile.
| Compound Name | 3-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 54584297 |
| Molecular Formula | C13H7N3O2S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 3-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]-5-nitrobenzonitrile |
| SMILES | Cc1nc(C#Cc2cc(C#N)cc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C13H7N3O2S/c1-9-15-12(8-19-9)3-2-10-4-11(7-14)6-13(5-10)16(17)18/h4-6,8H,1H3 |
| InChIKey | NYDDBVSTHZVPKD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|