C23H15N3OS — CID 134261216
2-(1H-isoquinoline-2-carbonyl)-4-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile (PubChem CID 134261216) has the molecular formula C23H15N3OS and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-(1H-isoquinoline-2-carbonyl)-4-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile.
| Compound Name | 2-(1H-isoquinoline-2-carbonyl)-4-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile |
|---|---|
| PubChem CID | 134261216 |
| Molecular Formula | C23H15N3OS |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-(1H-isoquinoline-2-carbonyl)-4-[2-(2-methyl-1,3-thiazol-4-yl)ethynyl]benzonitrile |
| SMILES | Cc1nc(C#Cc2ccc(C#N)c(C(=O)N3C=Cc4ccccc4C3)c2)cs1 |
| InChI | InChI=1S/C23H15N3OS/c1-16-25-21(15-28-16)9-7-17-6-8-19(13-24)22(12-17)23(27)26-11-10-18-4-2-3-5-20(18)14-26/h2-6,8,10-12,15H,14H2,1H3 |
| InChIKey | HQDIKMDTHNAIAM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|