C22H15N3OS — CID 71713464
3-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbonyl]benzonitrile (PubChem CID 71713464) has the molecular formula C22H15N3OS and a molecular weight of 369.45 g/mol. Its IUPAC name is 3-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbonyl]benzonitrile.
| Compound Name | 3-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 71713464 |
| Molecular Formula | C22H15N3OS |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 3-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbonyl]benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CCc3nc(C#Cc4ccccc4)sc3C2)c1 |
| InChI | InChI=1S/C22H15N3OS/c23-14-17-7-4-8-18(13-17)22(26)25-12-11-19-20(15-25)27-21(24-19)10-9-16-5-2-1-3-6-16/h1-8,13H,11-12,15H2 |
| InChIKey | XSPHDAGQCCKCGZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|