C20H20N2OS — CID 71713022
cyclopentyl-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone (PubChem CID 71713022) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is cyclopentyl-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone.
| Compound Name | cyclopentyl-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 71713022 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | cyclopentyl-[2-(2-phenylethynyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCc2nc(C#Cc3ccccc3)sc2C1 |
| InChI | InChI=1S/C20H20N2OS/c23-20(16-8-4-5-9-16)22-13-12-17-18(14-22)24-19(21-17)11-10-15-6-2-1-3-7-15/h1-3,6-7,16H,4-5,8-9,12-14H2 |
| InChIKey | SWTLXBNFAVZGCX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|