C14H10N2OS — CID 53246019
2-(2-phenylethynyl)-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 53246019) has the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-(2-phenylethynyl)-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 2-(2-phenylethynyl)-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 53246019 |
| Molecular Formula | C14H10N2OS |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-(2-phenylethynyl)-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | O=C1NCCc2nc(C#Cc3ccccc3)sc21 |
| InChI | InChI=1S/C14H10N2OS/c17-14-13-11(8-9-15-14)16-12(18-13)7-6-10-4-2-1-3-5-10/h1-5H,8-9H2,(H,15,17) |
| InChIKey | WZLVLKNPYINXHX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|