C14H9FN2OS — CID 71712435
2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 71712435) has the molecular formula C14H9FN2OS and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 71712435 |
| Molecular Formula | C14H9FN2OS |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethynyl]-6,7-dihydro-5H-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | O=C1NCCc2nc(C#Cc3cccc(F)c3)sc21 |
| InChI | InChI=1S/C14H9FN2OS/c15-10-3-1-2-9(8-10)4-5-12-17-11-6-7-16-14(18)13(11)19-12/h1-3,8H,6-7H2,(H,16,18) |
| InChIKey | BNTBDLUANMYFHE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|