About 4,7-diethyldodecan-6-ol
4,7-diethyldodecan-6-ol (PubChem CID 545879) has the molecular formula C16H34O
and a molecular weight of 242.45 g/mol. Its IUPAC name is 4,7-diethyldodecan-6-ol.
Molecular Properties
| Compound Name | 4,7-diethyldodecan-6-ol |
| PubChem CID | 545879 |
| Molecular Formula | C16H34O |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.26 |
| IUPAC Name | 4,7-diethyldodecan-6-ol |
| SMILES | CCCCCC(CC)C(O)CC(CC)CCC |
| InChI | InChI=1S/C16H34O/c1-5-9-10-12-15(8-4)16(17)13-14(7-3)11-6-2/h14-17H,5-13H2,1-4H3 |
| InChIKey | OSGZPPIHWAXBGA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,7-diethyldodecan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diethyldodecan-6-ol?
The IUPAC name of 4,7-diethyldodecan-6-ol (CID 545879) is 4,7-diethyldodecan-6-ol.
What is the SMILES notation for 4,7-diethyldodecan-6-ol?
The canonical SMILES for 4,7-diethyldodecan-6-ol is CCCCCC(CC)C(O)CC(CC)CCC.
What is the InChIKey of 4,7-diethyldodecan-6-ol?
The InChIKey is OSGZPPIHWAXBGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O/c1-5-9-10-12-15(8-4)16(17)13-14(7-3)11-6-2/h14-17H,5-13H2,1-4H3.
What are the key properties of 4,7-diethyldodecan-6-ol?
4,7-diethyldodecan-6-ol has a molecular weight of 242.45 g/mol, XLogP of 5.17, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diethyldodecan-6-ol is sourced from PubChem (CID 545879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).