About 5-ethyl-2-iodononan-4-ol
5-ethyl-2-iodononan-4-ol (PubChem CID 118984335) has the molecular formula C11H23IO
and a molecular weight of 298.21 g/mol. Its IUPAC name is 5-ethyl-2-iodononan-4-ol.
Molecular Properties
| Compound Name | 5-ethyl-2-iodononan-4-ol |
| PubChem CID | 118984335 |
| Molecular Formula | C11H23IO |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-ethyl-2-iodononan-4-ol |
| SMILES | CCCCC(CC)C(O)CC(C)I |
| InChI | InChI=1S/C11H23IO/c1-4-6-7-10(5-2)11(13)8-9(3)12/h9-11,13H,4-8H2,1-3H3 |
| InChIKey | BPBKJNSEKXEQJT-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2-iodononan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-iodononan-4-ol?
The IUPAC name of 5-ethyl-2-iodononan-4-ol (CID 118984335) is 5-ethyl-2-iodononan-4-ol.
What is the SMILES notation for 5-ethyl-2-iodononan-4-ol?
The canonical SMILES for 5-ethyl-2-iodononan-4-ol is CCCCC(CC)C(O)CC(C)I.
What is the InChIKey of 5-ethyl-2-iodononan-4-ol?
The InChIKey is BPBKJNSEKXEQJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23IO/c1-4-6-7-10(5-2)11(13)8-9(3)12/h9-11,13H,4-8H2,1-3H3.
What are the key properties of 5-ethyl-2-iodononan-4-ol?
5-ethyl-2-iodononan-4-ol has a molecular weight of 298.21 g/mol, XLogP of 3.78, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-iodononan-4-ol is sourced from PubChem (CID 118984335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).