C21H14F2N4O7S — CID 54589522
3-(3,4-difluorophenyl)-1'-[(5-methyl-1,2-oxazol-3-yl)methyl]-5'-nitro-1,1-dioxospiro[1,3-thiazolidine-2,3'-indole]-2',4-dione (PubChem CID 54589522) has the molecular formula C21H14F2N4O7S and a molecular weight of 504.43 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-1'-[(5-methyl-1,2-oxazol-3-yl)methyl]-5'-nitro-1,1-dioxospiro[1,3-thiazolidine-2,3'-indole]-2',4-dione.
| Compound Name | 3-(3,4-difluorophenyl)-1'-[(5-methyl-1,2-oxazol-3-yl)methyl]-5'-nitro-1,1-dioxospiro[1,3-thiazolidine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 54589522 |
| Molecular Formula | C21H14F2N4O7S |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | 3-(3,4-difluorophenyl)-1'-[(5-methyl-1,2-oxazol-3-yl)methyl]-5'-nitro-1,1-dioxospiro[1,3-thiazolidine-2,3'-indole]-2',4-dione |
| SMILES | Cc1cc(CN2C(=O)C3(c4cc([N+](=O)[O-])ccc42)N(c2ccc(F)c(F)c2)C(=O)CS3(=O)=O)no1 |
| InChI | InChI=1S/C21H14F2N4O7S/c1-11-6-12(24-34-11)9-25-18-5-3-14(27(30)31)7-15(18)21(20(25)29)26(19(28)10-35(21,32)33)13-2-4-16(22)17(23)8-13/h2-8H,9-10H2,1H3 |
| InChIKey | SAZFAZCKAUMRMQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 143.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|