C23H14Cl2FN3O5S — CID 54590643
3-(3-chloro-4-fluorophenyl)-1'-[(4-chlorophenyl)methyl]-5'-nitro-1-oxospiro[1,3-thiazolidine-2,3'-indole]-2',4-dione (PubChem CID 54590643) has the molecular formula C23H14Cl2FN3O5S and a molecular weight of 534.35 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-1'-[(4-chlorophenyl)methyl]-5'-nitro-1-oxospiro[1,3-thiazolidine-2,3'-indole]-2',4-dione.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-1'-[(4-chlorophenyl)methyl]-5'-nitro-1-oxospiro[1,3-thiazolidine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 54590643 |
| Molecular Formula | C23H14Cl2FN3O5S |
| Molecular Weight | 534.35 g/mol |
| Exact Mass | 533.00 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-1'-[(4-chlorophenyl)methyl]-5'-nitro-1-oxospiro[1,3-thiazolidine-2,3'-indole]-2',4-dione |
| SMILES | O=C1CS(=O)C2(C(=O)N(Cc3ccc(Cl)cc3)c3ccc([N+](=O)[O-])cc32)N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C23H14Cl2FN3O5S/c24-14-3-1-13(2-4-14)11-27-20-8-6-16(29(32)33)9-17(20)23(22(27)31)28(21(30)12-35(23)34)15-5-7-19(26)18(25)10-15/h1-10H,11-12H2 |
| InChIKey | XDZPQMSKNUAQFO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.35 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|