C19H30O7 — CID 54590388
(1R,3S,7R,8S,9S,10R,12R,13S,14S)-9-(methoxymethoxy)-8,13,14-trimethylspiro[2,6,11-trioxatricyclo[8.4.0.03,7]tetradecane-12,2'-oxolane]-5-one (PubChem CID 54590388) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is (1R,3S,7R,8S,9S,10R,12R,13S,14S)-9-(methoxymethoxy)-8,13,14-trimethylspiro[2,6,11-trioxatricyclo[8.4.0.03,7]tetradecane-12,2'-oxolane]-5-one.
| Compound Name | (1R,3S,7R,8S,9S,10R,12R,13S,14S)-9-(methoxymethoxy)-8,13,14-trimethylspiro[2,6,11-trioxatricyclo[8.4.0.03,7]tetradecane-12,2'-oxolane]-5-one |
|---|---|
| PubChem CID | 54590388 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (1R,3S,7R,8S,9S,10R,12R,13S,14S)-9-(methoxymethoxy)-8,13,14-trimethylspiro[2,6,11-trioxatricyclo[8.4.0.03,7]tetradecane-12,2'-oxolane]-5-one |
| SMILES | COCO[C@H]1[C@H](C)[C@H]2OC(=O)C[C@@H]2O[C@@H]2[C@@H](C)[C@H](C)[C@@]3(CCCO3)O[C@H]21 |
| InChI | InChI=1S/C19H30O7/c1-10-12(3)19(6-5-7-23-19)26-18-16(22-9-21-4)11(2)15-13(24-17(10)18)8-14(20)25-15/h10-13,15-18H,5-9H2,1-4H3/t10-,11+,12-,13-,15+,16-,17+,18-,19+/m0/s1 |
| InChIKey | WHNGZLUXIPNYSL-VGQLTXAWSA-N |
| XLogP | 1.87 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|