C6H15ClN2O2 — CID 54595044
N-methyl-2-[2-(methylamino)ethoxy]acetamide;hydrochloride (PubChem CID 54595044) has the molecular formula C6H15ClN2O2 and a molecular weight of 182.65 g/mol. Its IUPAC name is N-methyl-2-[2-(methylamino)ethoxy]acetamide;hydrochloride.
| Compound Name | N-methyl-2-[2-(methylamino)ethoxy]acetamide;hydrochloride |
|---|---|
| PubChem CID | 54595044 |
| Molecular Formula | C6H15ClN2O2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | N-methyl-2-[2-(methylamino)ethoxy]acetamide;hydrochloride |
| SMILES | CNCCOCC(=O)NC.Cl |
| InChI | InChI=1S/C6H14N2O2.ClH/c1-7-3-4-10-5-6(9)8-2;/h7H,3-5H2,1-2H3,(H,8,9);1H |
| InChIKey | FZWHVLYVFCCMBU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|