C26H41NO4Si — CID 54597395
(4R)-4-benzyl-3-[(E,2S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-6-methylhept-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 54597395) has the molecular formula C26H41NO4Si and a molecular weight of 459.70 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(E,2S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-6-methylhept-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(E,2S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-6-methylhept-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54597395 |
| Molecular Formula | C26H41NO4Si |
| Molecular Weight | 459.70 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | (4R)-4-benzyl-3-[(E,2S,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-6-methylhept-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H](C/C=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H41NO4Si/c1-8-22(16-12-13-20(2)18-31-32(6,7)26(3,4)5)24(28)27-23(19-30-25(27)29)17-21-14-10-9-11-15-21/h9-15,20,22-23H,8,16-19H2,1-7H3/b13-12+/t20-,22+,23-/m1/s1 |
| InChIKey | OMLRPVCGKKDAOH-DYMDWBQJSA-N |
| XLogP | 6.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.70 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|