C41H38BrN2P2+ — CID 54599228
triphenyl-[2-(5-triphenylphosphaniumyl-3,4-dihydropyrazol-2-yl)ethyl]phosphanium bromide (PubChem CID 54599228) has the molecular formula C41H38BrN2P2+ and a molecular weight of 700.62 g/mol. Its IUPAC name is triphenyl-[2-(5-triphenylphosphaniumyl-3,4-dihydropyrazol-2-yl)ethyl]phosphanium bromide.
| Compound Name | triphenyl-[2-(5-triphenylphosphaniumyl-3,4-dihydropyrazol-2-yl)ethyl]phosphanium bromide |
|---|---|
| PubChem CID | 54599228 |
| Molecular Formula | C41H38BrN2P2+ |
| Molecular Weight | 700.62 g/mol |
| Exact Mass | 699.17 |
| IUPAC Name | triphenyl-[2-(5-triphenylphosphaniumyl-3,4-dihydropyrazol-2-yl)ethyl]phosphanium bromide |
| SMILES | [Br-].c1ccc([P+](CCN2CCC([P+](c3ccccc3)(c3ccccc3)c3ccccc3)=N2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C41H38N2P2.BrH/c1-7-19-35(20-8-1)44(36-21-9-2-10-22-36,37-23-11-3-12-24-37)34-33-43-32-31-41(42-43)45(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40;/h1-30H,31-34H2;1H/q+2;/p-1 |
| InChIKey | HCLHKIKXJGWXFP-UHFFFAOYSA-M |
| XLogP | 4.00 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|