About 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron
1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron (PubChem CID 54600070) has the molecular formula C11H16FeO2S
and a molecular weight of 268.16 g/mol. Its IUPAC name is 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron.
Molecular Properties
| Compound Name | 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron |
| PubChem CID | 54600070 |
| Molecular Formula | C11H16FeO2S |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron |
| SMILES | CCCC(C)c1ccc(SOO)cc1.[Fe] |
| InChI | InChI=1S/C11H16O2S.Fe/c1-3-4-9(2)10-5-7-11(8-6-10)14-13-12;/h5-9,12H,3-4H2,1-2H3; |
| InChIKey | RPFVHWCUKVNBEW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron?
The IUPAC name of 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron (CID 54600070) is 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron.
What is the SMILES notation for 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron?
The canonical SMILES for 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron is CCCC(C)c1ccc(SOO)cc1.[Fe].
What is the InChIKey of 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron?
The InChIKey is RPFVHWCUKVNBEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2S.Fe/c1-3-4-9(2)10-5-7-11(8-6-10)14-13-12;/h5-9,12H,3-4H2,1-2H3;.
What are the key properties of 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron?
1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron has a molecular weight of 268.16 g/mol, XLogP of 4.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroperoxysulfanyl-4-pentan-2-ylbenzene;iron is sourced from PubChem (CID 54600070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).